C34H28F6N2O6 — CID 144909708
3-tert-butyl-5-[5-[2-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]benzoic acid (PubChem CID 144909708) has the molecular formula C34H28F6N2O6 and a molecular weight of 674.59 g/mol. Its IUPAC name is 3-tert-butyl-5-[5-[2-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]benzoic acid.
| Compound Name | 3-tert-butyl-5-[5-[2-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 144909708 |
| Molecular Formula | C34H28F6N2O6 |
| Molecular Weight | 674.59 g/mol |
| Exact Mass | 674.19 |
| IUPAC Name | 3-tert-butyl-5-[5-[2-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]benzoic acid |
| SMILES | CC(C)(C)c1cc(C(=O)O)cc(N2C(=O)c3ccc(C(c4ccc5c(c4)C(=O)N(C(C)(C)C)C5=O)(C(F)(F)F)C(F)(F)F)cc3C2=O)c1 |
| InChI | InChI=1S/C34H28F6N2O6/c1-30(2,3)19-11-16(29(47)48)12-20(13-19)41-25(43)21-9-7-17(14-23(21)26(41)44)32(33(35,36)37,34(38,39)40)18-8-10-22-24(15-18)28(46)42(27(22)45)31(4,5)6/h7-15H,1-6H3,(H,47,48) |
| InChIKey | AWWAFLQLZSQSIX-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.59 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|