C13H12N4O2 — CID 102805951
5-amino-2-(1,3-dimethylpyrazol-4-yl)isoindole-1,3-dione (PubChem CID 102805951) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is 5-amino-2-(1,3-dimethylpyrazol-4-yl)isoindole-1,3-dione.
| Compound Name | 5-amino-2-(1,3-dimethylpyrazol-4-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 102805951 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 5-amino-2-(1,3-dimethylpyrazol-4-yl)isoindole-1,3-dione |
| SMILES | Cc1nn(C)cc1N1C(=O)c2ccc(N)cc2C1=O |
| InChI | InChI=1S/C13H12N4O2/c1-7-11(6-16(2)15-7)17-12(18)9-4-3-8(14)5-10(9)13(17)19/h3-6H,14H2,1-2H3 |
| InChIKey | NQNVWGRFBYOQAP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|