C10H9NO2S — CID 132842992
1-(4-sulfanylphenyl)pyrrolidine-2,5-dione (PubChem CID 132842992) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is 1-(4-sulfanylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 1-(4-sulfanylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 132842992 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 1-(4-sulfanylphenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1c1ccc(S)cc1 |
| InChI | InChI=1S/C10H9NO2S/c12-9-5-6-10(13)11(9)7-1-3-8(14)4-2-7/h1-4,14H,5-6H2 |
| InChIKey | HYIPDFMIGWBLBR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|