C18H26FNO2S2 — CID 155745317
[ditert-butyl-[4-(2,5-dioxopyrrolidin-1-yl)phenyl]-λ4-sulfanyl] thiohypofluorite (PubChem CID 155745317) has the molecular formula C18H26FNO2S2 and a molecular weight of 371.54 g/mol. Its IUPAC name is [ditert-butyl-[4-(2,5-dioxopyrrolidin-1-yl)phenyl]-λ4-sulfanyl] thiohypofluorite.
| Compound Name | [ditert-butyl-[4-(2,5-dioxopyrrolidin-1-yl)phenyl]-λ4-sulfanyl] thiohypofluorite |
|---|---|
| PubChem CID | 155745317 |
| Molecular Formula | C18H26FNO2S2 |
| Molecular Weight | 371.54 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | [ditert-butyl-[4-(2,5-dioxopyrrolidin-1-yl)phenyl]-λ4-sulfanyl] thiohypofluorite |
| SMILES | CC(C)(C)S(SF)(c1ccc(N2C(=O)CCC2=O)cc1)C(C)(C)C |
| InChI | InChI=1S/C18H26FNO2S2/c1-17(2,3)24(23-19,18(4,5)6)14-9-7-13(8-10-14)20-15(21)11-12-16(20)22/h7-10H,11-12H2,1-6H3 |
| InChIKey | SIFLMWHMCRCZPL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|