C14H18N2O4S — CID 873017
N-tert-butyl-4-(2,5-dioxopyrrolidin-1-yl)benzenesulfonamide (PubChem CID 873017) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-tert-butyl-4-(2,5-dioxopyrrolidin-1-yl)benzenesulfonamide.
| Compound Name | N-tert-butyl-4-(2,5-dioxopyrrolidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 873017 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-tert-butyl-4-(2,5-dioxopyrrolidin-1-yl)benzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C14H18N2O4S/c1-14(2,3)15-21(19,20)11-6-4-10(5-7-11)16-12(17)8-9-13(16)18/h4-7,15H,8-9H2,1-3H3 |
| InChIKey | ODNRIJQFFUCBTI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|