C16H17N5O6S — CID 122252851
N-[(4,6-dimethoxy-1,3,5-triazin-2-yl)methyl]-4-(2,5-dioxopyrrolidin-1-yl)benzenesulfonamide (PubChem CID 122252851) has the molecular formula C16H17N5O6S and a molecular weight of 407.41 g/mol. Its IUPAC name is N-[(4,6-dimethoxy-1,3,5-triazin-2-yl)methyl]-4-(2,5-dioxopyrrolidin-1-yl)benzenesulfonamide.
| Compound Name | N-[(4,6-dimethoxy-1,3,5-triazin-2-yl)methyl]-4-(2,5-dioxopyrrolidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 122252851 |
| Molecular Formula | C16H17N5O6S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | N-[(4,6-dimethoxy-1,3,5-triazin-2-yl)methyl]-4-(2,5-dioxopyrrolidin-1-yl)benzenesulfonamide |
| SMILES | COc1nc(CNS(=O)(=O)c2ccc(N3C(=O)CCC3=O)cc2)nc(OC)n1 |
| InChI | InChI=1S/C16H17N5O6S/c1-26-15-18-12(19-16(20-15)27-2)9-17-28(24,25)11-5-3-10(4-6-11)21-13(22)7-8-14(21)23/h3-6,17H,7-9H2,1-2H3 |
| InChIKey | MBXWTFSSYCPWGI-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|