C20H22N2O7S — CID 100540260
4-(2,5-dioxopyrrolidin-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]benzenesulfonamide (PubChem CID 100540260) has the molecular formula C20H22N2O7S and a molecular weight of 434.47 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]benzenesulfonamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 100540260 |
| Molecular Formula | C20H22N2O7S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]benzenesulfonamide |
| SMILES | COc1cc(CNS(=O)(=O)c2ccc(N3C(=O)CCC3=O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H22N2O7S/c1-27-16-10-13(11-17(28-2)20(16)29-3)12-21-30(25,26)15-6-4-14(5-7-15)22-18(23)8-9-19(22)24/h4-7,10-11,21H,8-9,12H2,1-3H3 |
| InChIKey | ZMUALMFNGKPQDT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|