C13H17N3O3 — CID 154467323
5-(4-amino-2-methoxyphenyl)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 154467323) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 5-(4-amino-2-methoxyphenyl)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 5-(4-amino-2-methoxyphenyl)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 154467323 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 5-(4-amino-2-methoxyphenyl)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | COc1cc(N)ccc1N1CC2CC1CN2C(=O)O |
| InChI | InChI=1S/C13H17N3O3/c1-19-12-4-8(14)2-3-11(12)15-6-10-5-9(15)7-16(10)13(17)18/h2-4,9-10H,5-7,14H2,1H3,(H,17,18) |
| InChIKey | KGONZKJBVJQLEB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|