C12H20N2O3 — CID 175978634
butyl 6-acetyl-2,6-diazaspiro[3.3]heptane-2-carboxylate (PubChem CID 175978634) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is butyl 6-acetyl-2,6-diazaspiro[3.3]heptane-2-carboxylate.
| Compound Name | butyl 6-acetyl-2,6-diazaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 175978634 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | butyl 6-acetyl-2,6-diazaspiro[3.3]heptane-2-carboxylate |
| SMILES | CCCCOC(=O)N1CC2(CN(C(C)=O)C2)C1 |
| InChI | InChI=1S/C12H20N2O3/c1-3-4-5-17-11(16)14-8-12(9-14)6-13(7-12)10(2)15/h3-9H2,1-2H3 |
| InChIKey | RNVYCANPSZSTLJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|