C20H27NO3 — CID 175842462
butyl 6-(3-cyclopropylphenyl)-6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate (PubChem CID 175842462) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is butyl 6-(3-cyclopropylphenyl)-6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate.
| Compound Name | butyl 6-(3-cyclopropylphenyl)-6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 175842462 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | butyl 6-(3-cyclopropylphenyl)-6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate |
| SMILES | CCCCOC(=O)N1CC2(C1)CC(O)(c1cccc(C3CC3)c1)C2 |
| InChI | InChI=1S/C20H27NO3/c1-2-3-9-24-18(22)21-13-19(14-21)11-20(23,12-19)17-6-4-5-16(10-17)15-7-8-15/h4-6,10,15,23H,2-3,7-9,11-14H2,1H3 |
| InChIKey | GONIZWVQBHPTKP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|