C25H42N2O4 — CID 163370217
butyl 3-amino-2-[[4-(3-hydroxyphenyl)cyclohexyl]oxymethyl]piperidine-1-carboxylate;ethane (PubChem CID 163370217) has the molecular formula C25H42N2O4 and a molecular weight of 434.62 g/mol. Its IUPAC name is butyl 3-amino-2-[[4-(3-hydroxyphenyl)cyclohexyl]oxymethyl]piperidine-1-carboxylate;ethane.
| Compound Name | butyl 3-amino-2-[[4-(3-hydroxyphenyl)cyclohexyl]oxymethyl]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 163370217 |
| Molecular Formula | C25H42N2O4 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.31 |
| IUPAC Name | butyl 3-amino-2-[[4-(3-hydroxyphenyl)cyclohexyl]oxymethyl]piperidine-1-carboxylate;ethane |
| SMILES | CC.CCCCOC(=O)N1CCCC(N)C1COC1CCC(c2cccc(O)c2)CC1 |
| InChI | InChI=1S/C23H36N2O4.C2H6/c1-2-3-14-28-23(27)25-13-5-8-21(24)22(25)16-29-20-11-9-17(10-12-20)18-6-4-7-19(26)15-18;1-2/h4,6-7,15,17,20-22,26H,2-3,5,8-14,16,24H2,1H3;1-2H3 |
| InChIKey | DAYYVMHDGSFVNM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|