C21H30N2O3 — CID 166854291
1-[(2R,3S)-3-amino-2-[(4-phenylcyclohexyl)oxymethyl]piperidin-1-yl]propane-1,2-dione (PubChem CID 166854291) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is 1-[(2R,3S)-3-amino-2-[(4-phenylcyclohexyl)oxymethyl]piperidin-1-yl]propane-1,2-dione.
| Compound Name | 1-[(2R,3S)-3-amino-2-[(4-phenylcyclohexyl)oxymethyl]piperidin-1-yl]propane-1,2-dione |
|---|---|
| PubChem CID | 166854291 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 1-[(2R,3S)-3-amino-2-[(4-phenylcyclohexyl)oxymethyl]piperidin-1-yl]propane-1,2-dione |
| SMILES | CC(=O)C(=O)N1CCC[C@H](N)[C@@H]1COC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H30N2O3/c1-15(24)21(25)23-13-5-8-19(22)20(23)14-26-18-11-9-17(10-12-18)16-6-3-2-4-7-16/h2-4,6-7,17-20H,5,8-14,22H2,1H3/t17?,18?,19-,20-/m0/s1 |
| InChIKey | SNPGNJNALYOBQH-GUMHCPJTSA-N |
| XLogP | 2.64 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|