C14H18N2O2 — CID 145054628
butyl 2-(1-methylpyrrolo[2,3-b]pyridin-5-yl)acetate (PubChem CID 145054628) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is butyl 2-(1-methylpyrrolo[2,3-b]pyridin-5-yl)acetate.
| Compound Name | butyl 2-(1-methylpyrrolo[2,3-b]pyridin-5-yl)acetate |
|---|---|
| PubChem CID | 145054628 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | butyl 2-(1-methylpyrrolo[2,3-b]pyridin-5-yl)acetate |
| SMILES | CCCCOC(=O)Cc1cnc2c(ccn2C)c1 |
| InChI | InChI=1S/C14H18N2O2/c1-3-4-7-18-13(17)9-11-8-12-5-6-16(2)14(12)15-10-11/h5-6,8,10H,3-4,7,9H2,1-2H3 |
| InChIKey | NYQNBNNIOAZODD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|