C27H31N5OS2 — CID 143742145
1-cyclopropyl-3-[4-[4-morpholin-4-yl-6-(2-phenylsulfanylpropan-2-yl)pyrimidin-2-yl]phenyl]thiourea (PubChem CID 143742145) has the molecular formula C27H31N5OS2 and a molecular weight of 505.71 g/mol. Its IUPAC name is 1-cyclopropyl-3-[4-[4-morpholin-4-yl-6-(2-phenylsulfanylpropan-2-yl)pyrimidin-2-yl]phenyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[4-[4-morpholin-4-yl-6-(2-phenylsulfanylpropan-2-yl)pyrimidin-2-yl]phenyl]thiourea |
|---|---|
| PubChem CID | 143742145 |
| Molecular Formula | C27H31N5OS2 |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 1-cyclopropyl-3-[4-[4-morpholin-4-yl-6-(2-phenylsulfanylpropan-2-yl)pyrimidin-2-yl]phenyl]thiourea |
| SMILES | CC(C)(Sc1ccccc1)c1cc(N2CCOCC2)nc(-c2ccc(NC(=S)NC3CC3)cc2)n1 |
| InChI | InChI=1S/C27H31N5OS2/c1-27(2,35-22-6-4-3-5-7-22)23-18-24(32-14-16-33-17-15-32)31-25(30-23)19-8-10-20(11-9-19)28-26(34)29-21-12-13-21/h3-11,18,21H,12-17H2,1-2H3,(H2,28,29,34) |
| InChIKey | XKBDLSDWLJQISA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|