C18H23N7O3 — CID 145053350
[5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)-2-pyridinyl]urea (PubChem CID 145053350) has the molecular formula C18H23N7O3 and a molecular weight of 385.43 g/mol. Its IUPAC name is [5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)-2-pyridinyl]urea.
| Compound Name | [5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 145053350 |
| Molecular Formula | C18H23N7O3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | [5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)-2-pyridinyl]urea |
| SMILES | NC(=O)Nc1ccc(-c2cc(N3CCOCC3)nc(N3CCOCC3)n2)cn1 |
| InChI | InChI=1S/C18H23N7O3/c19-17(26)22-15-2-1-13(12-20-15)14-11-16(24-3-7-27-8-4-24)23-18(21-14)25-5-9-28-10-6-25/h1-2,11-12H,3-10H2,(H3,19,20,22,26) |
| InChIKey | IGAJCAZGHXQTSZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |