C15H17N5O2 — CID 68760220
[2-(2-morpholin-4-ylpyrimidin-4-yl)phenyl]urea (PubChem CID 68760220) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is [2-(2-morpholin-4-ylpyrimidin-4-yl)phenyl]urea.
| Compound Name | [2-(2-morpholin-4-ylpyrimidin-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 68760220 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [2-(2-morpholin-4-ylpyrimidin-4-yl)phenyl]urea |
| SMILES | NC(=O)Nc1ccccc1-c1ccnc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H17N5O2/c16-14(21)18-12-4-2-1-3-11(12)13-5-6-17-15(19-13)20-7-9-22-10-8-20/h1-6H,7-10H2,(H3,16,18,21) |
| InChIKey | VZCYEEQDAOCYSO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |