C17H18N6O2 — CID 68794286
[2-(5-morpholin-4-ylimidazo[1,2-c]pyrimidin-8-yl)phenyl]urea (PubChem CID 68794286) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is [2-(5-morpholin-4-ylimidazo[1,2-c]pyrimidin-8-yl)phenyl]urea.
| Compound Name | [2-(5-morpholin-4-ylimidazo[1,2-c]pyrimidin-8-yl)phenyl]urea |
|---|---|
| PubChem CID | 68794286 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | [2-(5-morpholin-4-ylimidazo[1,2-c]pyrimidin-8-yl)phenyl]urea |
| SMILES | NC(=O)Nc1ccccc1-c1cnc(N2CCOCC2)n2ccnc12 |
| InChI | InChI=1S/C17H18N6O2/c18-16(24)21-14-4-2-1-3-12(14)13-11-20-17(22-7-9-25-10-8-22)23-6-5-19-15(13)23/h1-6,11H,7-10H2,(H3,18,21,24) |
| InChIKey | UDFFPWVEHIOWSX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |