C19H20F2N6O2S — CID 155799527
6-[5-[(3,5-difluorophenyl)methylsulfonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-9-methylpurine (PubChem CID 155799527) has the molecular formula C19H20F2N6O2S and a molecular weight of 434.47 g/mol. Its IUPAC name is 6-[5-[(3,5-difluorophenyl)methylsulfonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-9-methylpurine.
| Compound Name | 6-[5-[(3,5-difluorophenyl)methylsulfonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-9-methylpurine |
|---|---|
| PubChem CID | 155799527 |
| Molecular Formula | C19H20F2N6O2S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 6-[5-[(3,5-difluorophenyl)methylsulfonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-9-methylpurine |
| SMILES | Cn1cnc2c(N3CC4CN(S(=O)(=O)Cc5cc(F)cc(F)c5)CC4C3)ncnc21 |
| InChI | InChI=1S/C19H20F2N6O2S/c1-25-11-24-17-18(25)22-10-23-19(17)26-5-13-7-27(8-14(13)6-26)30(28,29)9-12-2-15(20)4-16(21)3-12/h2-4,10-11,13-14H,5-9H2,1H3 |
| InChIKey | XSGKQTMPQXGWNE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |