C16H19FN4O2S — CID 171997094
4-[4-[(5-fluoro-3-pyridinyl)methyl]piperazin-1-yl]benzenesulfonamide (PubChem CID 171997094) has the molecular formula C16H19FN4O2S and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-[4-[(5-fluoro-3-pyridinyl)methyl]piperazin-1-yl]benzenesulfonamide.
| Compound Name | 4-[4-[(5-fluoro-3-pyridinyl)methyl]piperazin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 171997094 |
| Molecular Formula | C16H19FN4O2S |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 4-[4-[(5-fluoro-3-pyridinyl)methyl]piperazin-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2CCN(Cc3cncc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C16H19FN4O2S/c17-14-9-13(10-19-11-14)12-20-5-7-21(8-6-20)15-1-3-16(4-2-15)24(18,22)23/h1-4,9-11H,5-8,12H2,(H2,18,22,23) |
| InChIKey | DCUCMIGYNAQREU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |