C12H18FN3 — CID 104973765
1-[(5-fluoro-3-pyridinyl)methyl]-3,5-dimethylpiperazine (PubChem CID 104973765) has the molecular formula C12H18FN3 and a molecular weight of 223.29 g/mol. Its IUPAC name is 1-[(5-fluoro-3-pyridinyl)methyl]-3,5-dimethylpiperazine.
| Compound Name | 1-[(5-fluoro-3-pyridinyl)methyl]-3,5-dimethylpiperazine |
|---|---|
| PubChem CID | 104973765 |
| Molecular Formula | C12H18FN3 |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 1-[(5-fluoro-3-pyridinyl)methyl]-3,5-dimethylpiperazine |
| SMILES | CC1CN(Cc2cncc(F)c2)CC(C)N1 |
| InChI | InChI=1S/C12H18FN3/c1-9-6-16(7-10(2)15-9)8-11-3-12(13)5-14-4-11/h3-5,9-10,15H,6-8H2,1-2H3 |
| InChIKey | YIKXALSEHATDEN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |