C11H15FN2S — CID 126789555
4-[(5-fluoro-3-pyridinyl)methyl]-2-methylthiomorpholine (PubChem CID 126789555) has the molecular formula C11H15FN2S and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-[(5-fluoro-3-pyridinyl)methyl]-2-methylthiomorpholine.
| Compound Name | 4-[(5-fluoro-3-pyridinyl)methyl]-2-methylthiomorpholine |
|---|---|
| PubChem CID | 126789555 |
| Molecular Formula | C11H15FN2S |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 4-[(5-fluoro-3-pyridinyl)methyl]-2-methylthiomorpholine |
| SMILES | CC1CN(Cc2cncc(F)c2)CCS1 |
| InChI | InChI=1S/C11H15FN2S/c1-9-7-14(2-3-15-9)8-10-4-11(12)6-13-5-10/h4-6,9H,2-3,7-8H2,1H3 |
| InChIKey | UPRZSOIRCNUIMX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |