C22H25N3O3 — CID 145196968
(E)-4-morpholin-4-yl-N-[5-[3-(1-oxopropan-2-yl)phenyl]-2-pyridinyl]but-2-enamide (PubChem CID 145196968) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is (E)-4-morpholin-4-yl-N-[5-[3-(1-oxopropan-2-yl)phenyl]-2-pyridinyl]but-2-enamide.
| Compound Name | (E)-4-morpholin-4-yl-N-[5-[3-(1-oxopropan-2-yl)phenyl]-2-pyridinyl]but-2-enamide |
|---|---|
| PubChem CID | 145196968 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (E)-4-morpholin-4-yl-N-[5-[3-(1-oxopropan-2-yl)phenyl]-2-pyridinyl]but-2-enamide |
| SMILES | CC(C=O)c1cccc(-c2ccc(NC(=O)/C=C/CN3CCOCC3)nc2)c1 |
| InChI | InChI=1S/C22H25N3O3/c1-17(16-26)18-4-2-5-19(14-18)20-7-8-21(23-15-20)24-22(27)6-3-9-25-10-12-28-13-11-25/h2-8,14-17H,9-13H2,1H3,(H,23,24,27)/b6-3+ |
| InChIKey | WHCFMDYJUHDVCN-ZZXKWVIFSA-N |
| XLogP | 2.88 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|