C23H35N5O3 — CID 144587219
(E)-N-[3-[(2,5-dimethylpyrimidin-4-yl)amino]phenyl]-4-morpholin-4-ylbut-2-enamide;ethane;methanol (PubChem CID 144587219) has the molecular formula C23H35N5O3 and a molecular weight of 429.57 g/mol. Its IUPAC name is (E)-N-[3-[(2,5-dimethylpyrimidin-4-yl)amino]phenyl]-4-morpholin-4-ylbut-2-enamide;ethane;methanol.
| Compound Name | (E)-N-[3-[(2,5-dimethylpyrimidin-4-yl)amino]phenyl]-4-morpholin-4-ylbut-2-enamide;ethane;methanol |
|---|---|
| PubChem CID | 144587219 |
| Molecular Formula | C23H35N5O3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | (E)-N-[3-[(2,5-dimethylpyrimidin-4-yl)amino]phenyl]-4-morpholin-4-ylbut-2-enamide;ethane;methanol |
| SMILES | CC.CO.Cc1ncc(C)c(Nc2cccc(NC(=O)/C=C/CN3CCOCC3)c2)n1 |
| InChI | InChI=1S/C20H25N5O2.C2H6.CH4O/c1-15-14-21-16(2)22-20(15)24-18-6-3-5-17(13-18)23-19(26)7-4-8-25-9-11-27-12-10-25;2*1-2/h3-7,13-14H,8-12H2,1-2H3,(H,23,26)(H,21,22,24);1-2H3;2H,1H3/b7-4+;; |
| InChIKey | GBRVSGFFJZYUOA-RDRKJGRWSA-N |
| XLogP | 3.30 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|