C24H24ClFN6O2 — CID 42602134
(E)-N-[3-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]phenyl]-4-morpholin-4-ylbut-2-enamide (PubChem CID 42602134) has the molecular formula C24H24ClFN6O2 and a molecular weight of 482.95 g/mol. Its IUPAC name is (E)-N-[3-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]phenyl]-4-morpholin-4-ylbut-2-enamide.
| Compound Name | (E)-N-[3-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]phenyl]-4-morpholin-4-ylbut-2-enamide |
|---|---|
| PubChem CID | 42602134 |
| Molecular Formula | C24H24ClFN6O2 |
| Molecular Weight | 482.95 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | (E)-N-[3-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]phenyl]-4-morpholin-4-ylbut-2-enamide |
| SMILES | O=C(/C=C/CN1CCOCC1)Nc1cccc(Nc2cc(Nc3ccc(F)c(Cl)c3)ncn2)c1 |
| InChI | InChI=1S/C24H24ClFN6O2/c25-20-14-19(6-7-21(20)26)30-23-15-22(27-16-28-23)29-17-3-1-4-18(13-17)31-24(33)5-2-8-32-9-11-34-12-10-32/h1-7,13-16H,8-12H2,(H,31,33)(H2,27,28,29,30)/b5-2+ |
| InChIKey | LHMRQEXPEHNEIM-GORDUTHDSA-N |
| XLogP | 4.58 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.95 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|