C25H25ClFN5O2 — CID 159165259
N-[3-[[2-(3-chloro-4-fluoroanilino)-4-pyridinyl]amino]phenyl]-2-(morpholin-4-ylmethyl)prop-2-enamide (PubChem CID 159165259) has the molecular formula C25H25ClFN5O2 and a molecular weight of 481.96 g/mol. Its IUPAC name is N-[3-[[2-(3-chloro-4-fluoroanilino)-4-pyridinyl]amino]phenyl]-2-(morpholin-4-ylmethyl)prop-2-enamide.
| Compound Name | N-[3-[[2-(3-chloro-4-fluoroanilino)-4-pyridinyl]amino]phenyl]-2-(morpholin-4-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 159165259 |
| Molecular Formula | C25H25ClFN5O2 |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | N-[3-[[2-(3-chloro-4-fluoroanilino)-4-pyridinyl]amino]phenyl]-2-(morpholin-4-ylmethyl)prop-2-enamide |
| SMILES | C=C(CN1CCOCC1)C(=O)Nc1cccc(Nc2ccnc(Nc3ccc(F)c(Cl)c3)c2)c1 |
| InChI | InChI=1S/C25H25ClFN5O2/c1-17(16-32-9-11-34-12-10-32)25(33)31-19-4-2-3-18(13-19)29-21-7-8-28-24(15-21)30-20-5-6-23(27)22(26)14-20/h2-8,13-15H,1,9-12,16H2,(H,31,33)(H2,28,29,30) |
| InChIKey | KKZHCXJVOANLQM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|