C25H27FN6O — CID 143794355
(E)-N-[3-[[6-(4-fluoro-3-methylanilino)pyrimidin-4-yl]amino]phenyl]-4-pyrrolidin-1-ylbut-2-enamide (PubChem CID 143794355) has the molecular formula C25H27FN6O and a molecular weight of 446.53 g/mol. Its IUPAC name is (E)-N-[3-[[6-(4-fluoro-3-methylanilino)pyrimidin-4-yl]amino]phenyl]-4-pyrrolidin-1-ylbut-2-enamide.
| Compound Name | (E)-N-[3-[[6-(4-fluoro-3-methylanilino)pyrimidin-4-yl]amino]phenyl]-4-pyrrolidin-1-ylbut-2-enamide |
|---|---|
| PubChem CID | 143794355 |
| Molecular Formula | C25H27FN6O |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | (E)-N-[3-[[6-(4-fluoro-3-methylanilino)pyrimidin-4-yl]amino]phenyl]-4-pyrrolidin-1-ylbut-2-enamide |
| SMILES | Cc1cc(Nc2cc(Nc3cccc(NC(=O)/C=C/CN4CCCC4)c3)ncn2)ccc1F |
| InChI | InChI=1S/C25H27FN6O/c1-18-14-21(9-10-22(18)26)30-24-16-23(27-17-28-24)29-19-6-4-7-20(15-19)31-25(33)8-5-13-32-11-2-3-12-32/h4-10,14-17H,2-3,11-13H2,1H3,(H,31,33)(H2,27,28,29,30)/b8-5+ |
| InChIKey | YQZMVVHCNCJYDR-VMPITWQZSA-N |
| XLogP | 5.00 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|