C18H14F2N4O — CID 109356120
N-(3,4-difluorophenyl)-6-(3-methylanilino)pyrimidine-4-carboxamide (PubChem CID 109356120) has the molecular formula C18H14F2N4O and a molecular weight of 340.33 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-6-(3-methylanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-6-(3-methylanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109356120 |
| Molecular Formula | C18H14F2N4O |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-(3,4-difluorophenyl)-6-(3-methylanilino)pyrimidine-4-carboxamide |
| SMILES | Cc1cccc(Nc2cc(C(=O)Nc3ccc(F)c(F)c3)ncn2)c1 |
| InChI | InChI=1S/C18H14F2N4O/c1-11-3-2-4-12(7-11)23-17-9-16(21-10-22-17)18(25)24-13-5-6-14(19)15(20)8-13/h2-10H,1H3,(H,24,25)(H,21,22,23) |
| InChIKey | BHWISWPQBICCQR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |