C25H26N6O — CID 90877367
4-(but-3-yn-2-ylamino)-N-[3-[[6-(3-methylanilino)pyrimidin-4-yl]amino]phenyl]but-2-enamide (PubChem CID 90877367) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-(but-3-yn-2-ylamino)-N-[3-[[6-(3-methylanilino)pyrimidin-4-yl]amino]phenyl]but-2-enamide.
| Compound Name | 4-(but-3-yn-2-ylamino)-N-[3-[[6-(3-methylanilino)pyrimidin-4-yl]amino]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 90877367 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 4-(but-3-yn-2-ylamino)-N-[3-[[6-(3-methylanilino)pyrimidin-4-yl]amino]phenyl]but-2-enamide |
| SMILES | C#CC(C)NCC=CC(=O)Nc1cccc(Nc2cc(Nc3cccc(C)c3)ncn2)c1 |
| InChI | InChI=1S/C25H26N6O/c1-4-19(3)26-13-7-12-25(32)31-22-11-6-10-21(15-22)30-24-16-23(27-17-28-24)29-20-9-5-8-18(2)14-20/h1,5-12,14-17,19,26H,13H2,2-3H3,(H,31,32)(H2,27,28,29,30) |
| InChIKey | GMVJIYIGYNVMQU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|