C35H33N7O2 — CID 155535959
4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[6-(4-phenylanilino)pyrimidin-4-yl]amino]phenyl]benzamide (PubChem CID 155535959) has the molecular formula C35H33N7O2 and a molecular weight of 583.70 g/mol. Its IUPAC name is 4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[6-(4-phenylanilino)pyrimidin-4-yl]amino]phenyl]benzamide.
| Compound Name | 4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[6-(4-phenylanilino)pyrimidin-4-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 155535959 |
| Molecular Formula | C35H33N7O2 |
| Molecular Weight | 583.70 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | 4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[6-(4-phenylanilino)pyrimidin-4-yl]amino]phenyl]benzamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1ccc(C(=O)Nc2cccc(Nc3cc(Nc4ccc(-c5ccccc5)cc4)ncn3)c2)cc1 |
| InChI | InChI=1S/C35H33N7O2/c1-42(2)21-7-12-34(43)40-29-19-15-27(16-20-29)35(44)41-31-11-6-10-30(22-31)39-33-23-32(36-24-37-33)38-28-17-13-26(14-18-28)25-8-4-3-5-9-25/h3-20,22-24H,21H2,1-2H3,(H,40,43)(H,41,44)(H2,36,37,38,39)/b12-7+ |
| InChIKey | YYHURGHJHGISNF-KPKJPENVSA-N |
| XLogP | 6.94 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.70 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|