C32H29ClN6O2 — CID 123303314
N-[3-[[5-chloro-6-(1H-indol-3-yl)-2-pyridinyl]amino]phenyl]-4-[4-(dimethylamino)but-2-enoylamino]benzamide (PubChem CID 123303314) has the molecular formula C32H29ClN6O2 and a molecular weight of 565.08 g/mol. Its IUPAC name is N-[3-[[5-chloro-6-(1H-indol-3-yl)-2-pyridinyl]amino]phenyl]-4-[4-(dimethylamino)but-2-enoylamino]benzamide.
| Compound Name | N-[3-[[5-chloro-6-(1H-indol-3-yl)-2-pyridinyl]amino]phenyl]-4-[4-(dimethylamino)but-2-enoylamino]benzamide |
|---|---|
| PubChem CID | 123303314 |
| Molecular Formula | C32H29ClN6O2 |
| Molecular Weight | 565.08 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | N-[3-[[5-chloro-6-(1H-indol-3-yl)-2-pyridinyl]amino]phenyl]-4-[4-(dimethylamino)but-2-enoylamino]benzamide |
| SMILES | CN(C)CC=CC(=O)Nc1ccc(C(=O)Nc2cccc(Nc3ccc(Cl)c(-c4c[nH]c5ccccc45)n3)c2)cc1 |
| InChI | InChI=1S/C32H29ClN6O2/c1-39(2)18-6-11-30(40)36-22-14-12-21(13-15-22)32(41)37-24-8-5-7-23(19-24)35-29-17-16-27(33)31(38-29)26-20-34-28-10-4-3-9-25(26)28/h3-17,19-20,34H,18H2,1-2H3,(H,35,38)(H,36,40)(H,37,41) |
| InChIKey | ANJQEYFONVPWOA-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.08 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|