C32H38ClN7O2 — CID 154953380
N-[(3R)-7-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]heptan-3-yl]-4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]benzamide (PubChem CID 154953380) has the molecular formula C32H38ClN7O2 and a molecular weight of 588.16 g/mol. Its IUPAC name is N-[(3R)-7-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]heptan-3-yl]-4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]benzamide.
| Compound Name | N-[(3R)-7-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]heptan-3-yl]-4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 154953380 |
| Molecular Formula | C32H38ClN7O2 |
| Molecular Weight | 588.16 g/mol |
| Exact Mass | 587.28 |
| IUPAC Name | N-[(3R)-7-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]heptan-3-yl]-4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]benzamide |
| SMILES | CC[C@H](CCCCNc1ncc(Cl)c(-c2c[nH]c3ccccc23)n1)NC(=O)c1ccc(NC(=O)/C=C/CN(C)C)cc1 |
| InChI | InChI=1S/C32H38ClN7O2/c1-4-23(38-31(42)22-14-16-24(17-15-22)37-29(41)13-9-19-40(2)3)10-7-8-18-34-32-36-21-27(33)30(39-32)26-20-35-28-12-6-5-11-25(26)28/h5-6,9,11-17,20-21,23,35H,4,7-8,10,18-19H2,1-3H3,(H,37,41)(H,38,42)(H,34,36,39)/b13-9+/t23-/m1/s1 |
| InChIKey | SXNRPRUKEQVTGF-LEBWJFOGSA-N |
| XLogP | 6.13 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.16 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|