C32H30ClN7O2 — CID 74221473
N-[5-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-2-methylphenyl]-4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]benzamide (PubChem CID 74221473) has the molecular formula C32H30ClN7O2 and a molecular weight of 580.09 g/mol. Its IUPAC name is N-[5-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-2-methylphenyl]-4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]benzamide.
| Compound Name | N-[5-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-2-methylphenyl]-4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 74221473 |
| Molecular Formula | C32H30ClN7O2 |
| Molecular Weight | 580.09 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | N-[5-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-2-methylphenyl]-4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]benzamide |
| SMILES | Cc1ccc(Nc2ncc(Cl)c(-c3c[nH]c4ccccc34)n2)cc1NC(=O)c1ccc(NC(=O)/C=C/CN(C)C)cc1 |
| InChI | InChI=1S/C32H30ClN7O2/c1-20-10-13-23(37-32-35-19-26(33)30(39-32)25-18-34-27-8-5-4-7-24(25)27)17-28(20)38-31(42)21-11-14-22(15-12-21)36-29(41)9-6-16-40(2)3/h4-15,17-19,34H,16H2,1-3H3,(H,36,41)(H,38,42)(H,35,37,39)/b9-6+ |
| InChIKey | NFRHOOFTDGIPHX-RMKNXTFCSA-N |
| XLogP | 6.64 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.09 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|