C32H36N6O3 — CID 91235672
4-[methyl(2-propoxyethyl)amino]-N-[3-[[6-(4-phenoxyanilino)pyrimidin-4-yl]amino]phenyl]but-2-enamide (PubChem CID 91235672) has the molecular formula C32H36N6O3 and a molecular weight of 552.68 g/mol. Its IUPAC name is 4-[methyl(2-propoxyethyl)amino]-N-[3-[[6-(4-phenoxyanilino)pyrimidin-4-yl]amino]phenyl]but-2-enamide.
| Compound Name | 4-[methyl(2-propoxyethyl)amino]-N-[3-[[6-(4-phenoxyanilino)pyrimidin-4-yl]amino]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 91235672 |
| Molecular Formula | C32H36N6O3 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 4-[methyl(2-propoxyethyl)amino]-N-[3-[[6-(4-phenoxyanilino)pyrimidin-4-yl]amino]phenyl]but-2-enamide |
| SMILES | CCCOCCN(C)CC=CC(=O)Nc1cccc(Nc2cc(Nc3ccc(Oc4ccccc4)cc3)ncn2)c1 |
| InChI | InChI=1S/C32H36N6O3/c1-3-20-40-21-19-38(2)18-8-13-32(39)37-27-10-7-9-26(22-27)36-31-23-30(33-24-34-31)35-25-14-16-29(17-15-25)41-28-11-5-4-6-12-28/h4-17,22-24H,3,18-21H2,1-2H3,(H,37,39)(H2,33,34,35,36) |
| InChIKey | JHPDYTKRNXPDSN-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|