C29H29N5O4 — CID 121273721
4-[6-[[(E)-4-[2-methoxyethyl(methyl)amino]but-2-enoyl]amino]quinolin-4-yl]oxy-N-pyridin-2-ylbenzamide (PubChem CID 121273721) has the molecular formula C29H29N5O4 and a molecular weight of 511.58 g/mol. Its IUPAC name is 4-[6-[[(E)-4-[2-methoxyethyl(methyl)amino]but-2-enoyl]amino]quinolin-4-yl]oxy-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[6-[[(E)-4-[2-methoxyethyl(methyl)amino]but-2-enoyl]amino]quinolin-4-yl]oxy-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 121273721 |
| Molecular Formula | C29H29N5O4 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 4-[6-[[(E)-4-[2-methoxyethyl(methyl)amino]but-2-enoyl]amino]quinolin-4-yl]oxy-N-pyridin-2-ylbenzamide |
| SMILES | COCCN(C)C/C=C/C(=O)Nc1ccc2nccc(Oc3ccc(C(=O)Nc4ccccn4)cc3)c2c1 |
| InChI | InChI=1S/C29H29N5O4/c1-34(18-19-37-2)17-5-7-28(35)32-22-10-13-25-24(20-22)26(14-16-30-25)38-23-11-8-21(9-12-23)29(36)33-27-6-3-4-15-31-27/h3-16,20H,17-19H2,1-2H3,(H,32,35)(H,31,33,36)/b7-5+ |
| InChIKey | OGKKVJCWIKNMGU-FNORWQNLSA-N |
| XLogP | 4.75 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|