C24H19N5O2 — CID 121273423
4-[[6-(prop-2-enoylamino)quinolin-4-yl]amino]-N-pyridin-2-ylbenzamide (PubChem CID 121273423) has the molecular formula C24H19N5O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is 4-[[6-(prop-2-enoylamino)quinolin-4-yl]amino]-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[[6-(prop-2-enoylamino)quinolin-4-yl]amino]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 121273423 |
| Molecular Formula | C24H19N5O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 4-[[6-(prop-2-enoylamino)quinolin-4-yl]amino]-N-pyridin-2-ylbenzamide |
| SMILES | C=CC(=O)Nc1ccc2nccc(Nc3ccc(C(=O)Nc4ccccn4)cc3)c2c1 |
| InChI | InChI=1S/C24H19N5O2/c1-2-23(30)28-18-10-11-20-19(15-18)21(12-14-25-20)27-17-8-6-16(7-9-17)24(31)29-22-5-3-4-13-26-22/h2-15H,1H2,(H,25,27)(H,28,30)(H,26,29,31) |
| InChIKey | DDINTJGRZVZLFZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|