C30H23F6N5O6 — CID 121273693
4-[[6-(but-2-ynoylamino)quinolin-4-yl]amino]-N-(4-methyl-2-pyridinyl)benzamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 121273693) has the molecular formula C30H23F6N5O6 and a molecular weight of 663.53 g/mol. Its IUPAC name is 4-[[6-(but-2-ynoylamino)quinolin-4-yl]amino]-N-(4-methyl-2-pyridinyl)benzamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[[6-(but-2-ynoylamino)quinolin-4-yl]amino]-N-(4-methyl-2-pyridinyl)benzamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 121273693 |
| Molecular Formula | C30H23F6N5O6 |
| Molecular Weight | 663.53 g/mol |
| Exact Mass | 663.16 |
| IUPAC Name | 4-[[6-(but-2-ynoylamino)quinolin-4-yl]amino]-N-(4-methyl-2-pyridinyl)benzamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC#CC(=O)Nc1ccc2nccc(Nc3ccc(C(=O)Nc4cc(C)ccn4)cc3)c2c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H21N5O2.2C2HF3O2/c1-3-4-25(32)30-20-9-10-22-21(16-20)23(12-14-27-22)29-19-7-5-18(6-8-19)26(33)31-24-15-17(2)11-13-28-24;2*3-2(4,5)1(6)7/h5-16H,1-2H3,(H,27,29)(H,30,32)(H,28,31,33);2*(H,6,7) |
| InChIKey | GTFVJHLSJFZVQN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 170.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|