C25H19N5O3 — CID 121273577
4-[6-(but-2-ynoylamino)quinolin-4-yl]oxy-N-(4-methylpyrimidin-2-yl)benzamide (PubChem CID 121273577) has the molecular formula C25H19N5O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is 4-[6-(but-2-ynoylamino)quinolin-4-yl]oxy-N-(4-methylpyrimidin-2-yl)benzamide.
| Compound Name | 4-[6-(but-2-ynoylamino)quinolin-4-yl]oxy-N-(4-methylpyrimidin-2-yl)benzamide |
|---|---|
| PubChem CID | 121273577 |
| Molecular Formula | C25H19N5O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 4-[6-(but-2-ynoylamino)quinolin-4-yl]oxy-N-(4-methylpyrimidin-2-yl)benzamide |
| SMILES | CC#CC(=O)Nc1ccc2nccc(Oc3ccc(C(=O)Nc4nccc(C)n4)cc3)c2c1 |
| InChI | InChI=1S/C25H19N5O3/c1-3-4-23(31)29-18-7-10-21-20(15-18)22(12-14-26-21)33-19-8-5-17(6-9-19)24(32)30-25-27-13-11-16(2)28-25/h5-15H,1-2H3,(H,29,31)(H,27,28,30,32) |
| InChIKey | CJDPQDMVNXZFTH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|