C28H27N5O4 — CID 145059750
4-[6-[[(E)-4-(dimethylamino)but-2-enoyl]amino]quinolin-4-yl]oxy-N-(4-methoxy-2-pyridinyl)benzamide (PubChem CID 145059750) has the molecular formula C28H27N5O4 and a molecular weight of 497.56 g/mol. Its IUPAC name is 4-[6-[[(E)-4-(dimethylamino)but-2-enoyl]amino]quinolin-4-yl]oxy-N-(4-methoxy-2-pyridinyl)benzamide.
| Compound Name | 4-[6-[[(E)-4-(dimethylamino)but-2-enoyl]amino]quinolin-4-yl]oxy-N-(4-methoxy-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 145059750 |
| Molecular Formula | C28H27N5O4 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 4-[6-[[(E)-4-(dimethylamino)but-2-enoyl]amino]quinolin-4-yl]oxy-N-(4-methoxy-2-pyridinyl)benzamide |
| SMILES | COc1ccnc(NC(=O)c2ccc(Oc3ccnc4ccc(NC(=O)/C=C/CN(C)C)cc34)cc2)c1 |
| InChI | InChI=1S/C28H27N5O4/c1-33(2)16-4-5-27(34)31-20-8-11-24-23(17-20)25(13-15-29-24)37-21-9-6-19(7-10-21)28(35)32-26-18-22(36-3)12-14-30-26/h4-15,17-18H,16H2,1-3H3,(H,31,34)(H,30,32,35)/b5-4+ |
| InChIKey | WFPLQNRSOTVRHX-SNAWJCMRSA-N |
| XLogP | 4.74 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|