C26H21N5O4 — CID 121273677
4-[6-(4-methoxybut-2-ynoylamino)quinolin-4-yl]oxy-N-(4-methylpyrimidin-2-yl)benzamide (PubChem CID 121273677) has the molecular formula C26H21N5O4 and a molecular weight of 467.49 g/mol. Its IUPAC name is 4-[6-(4-methoxybut-2-ynoylamino)quinolin-4-yl]oxy-N-(4-methylpyrimidin-2-yl)benzamide.
| Compound Name | 4-[6-(4-methoxybut-2-ynoylamino)quinolin-4-yl]oxy-N-(4-methylpyrimidin-2-yl)benzamide |
|---|---|
| PubChem CID | 121273677 |
| Molecular Formula | C26H21N5O4 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 4-[6-(4-methoxybut-2-ynoylamino)quinolin-4-yl]oxy-N-(4-methylpyrimidin-2-yl)benzamide |
| SMILES | COCC#CC(=O)Nc1ccc2nccc(Oc3ccc(C(=O)Nc4nccc(C)n4)cc3)c2c1 |
| InChI | InChI=1S/C26H21N5O4/c1-17-11-13-28-26(29-17)31-25(33)18-5-8-20(9-6-18)35-23-12-14-27-22-10-7-19(16-21(22)23)30-24(32)4-3-15-34-2/h5-14,16H,15H2,1-2H3,(H,30,32)(H,28,29,31,33) |
| InChIKey | GLAIYKBHKOFZDQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|