C28H26N2O6 — CID 139803936
ethyl 2-benzamido-2-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]acetate (PubChem CID 139803936) has the molecular formula C28H26N2O6 and a molecular weight of 486.52 g/mol. Its IUPAC name is ethyl 2-benzamido-2-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]acetate.
| Compound Name | ethyl 2-benzamido-2-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]acetate |
|---|---|
| PubChem CID | 139803936 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | ethyl 2-benzamido-2-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]acetate |
| SMILES | CCOC(=O)C(NC(=O)c1ccccc1)c1ccc(Oc2ccnc3cc(OC)c(OC)cc23)cc1 |
| InChI | InChI=1S/C28H26N2O6/c1-4-35-28(32)26(30-27(31)19-8-6-5-7-9-19)18-10-12-20(13-11-18)36-23-14-15-29-22-17-25(34-3)24(33-2)16-21(22)23/h5-17,26H,4H2,1-3H3,(H,30,31) |
| InChIKey | MASUQICIRNGNTD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |