C40H41N3O6 — CID 15605353
cyclopentyl (2S)-2-[4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxybutylamino]-2-phenylacetate (PubChem CID 15605353) has the molecular formula C40H41N3O6 and a molecular weight of 659.78 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxybutylamino]-2-phenylacetate.
| Compound Name | cyclopentyl (2S)-2-[4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxybutylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 15605353 |
| Molecular Formula | C40H41N3O6 |
| Molecular Weight | 659.78 g/mol |
| Exact Mass | 659.30 |
| IUPAC Name | cyclopentyl (2S)-2-[4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxybutylamino]-2-phenylacetate |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)c4ccccc4)cc3)ccnc2cc1OCCCCN[C@H](C(=O)OC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C40H41N3O6/c1-46-36-26-33-34(41-24-22-35(33)48-32-20-18-30(19-21-32)43-39(44)29-14-6-3-7-15-29)27-37(36)47-25-11-10-23-42-38(28-12-4-2-5-13-28)40(45)49-31-16-8-9-17-31/h2-7,12-15,18-22,24,26-27,31,38,42H,8-11,16-17,23,25H2,1H3,(H,43,44)/t38-/m0/s1 |
| InChIKey | FXEHFVTYKDWZSM-LHEWISCISA-N |
| XLogP | 8.26 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.78 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|