C32H34N4O5 — CID 67265173
cyclopentyl 2-amino-4-[4-(4-benzamidoanilino)-6-methoxyquinolin-7-yl]oxybutanoate (PubChem CID 67265173) has the molecular formula C32H34N4O5 and a molecular weight of 554.65 g/mol. Its IUPAC name is cyclopentyl 2-amino-4-[4-(4-benzamidoanilino)-6-methoxyquinolin-7-yl]oxybutanoate.
| Compound Name | cyclopentyl 2-amino-4-[4-(4-benzamidoanilino)-6-methoxyquinolin-7-yl]oxybutanoate |
|---|---|
| PubChem CID | 67265173 |
| Molecular Formula | C32H34N4O5 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | cyclopentyl 2-amino-4-[4-(4-benzamidoanilino)-6-methoxyquinolin-7-yl]oxybutanoate |
| SMILES | COc1cc2c(Nc3ccc(NC(=O)c4ccccc4)cc3)ccnc2cc1OCCC(N)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C32H34N4O5/c1-39-29-19-25-27(35-22-11-13-23(14-12-22)36-31(37)21-7-3-2-4-8-21)15-17-34-28(25)20-30(29)40-18-16-26(33)32(38)41-24-9-5-6-10-24/h2-4,7-8,11-15,17,19-20,24,26H,5-6,9-10,16,18,33H2,1H3,(H,34,35)(H,36,37) |
| InChIKey | CSRPYMJYBMYBAS-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |