C34H35F3N4O5S — CID 15602833
cyclopentyl (2R)-2-amino-5-[6-methoxy-4-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfanylquinolin-7-yl]oxypentanoate (PubChem CID 15602833) has the molecular formula C34H35F3N4O5S and a molecular weight of 668.74 g/mol. Its IUPAC name is cyclopentyl (2R)-2-amino-5-[6-methoxy-4-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfanylquinolin-7-yl]oxypentanoate.
| Compound Name | cyclopentyl (2R)-2-amino-5-[6-methoxy-4-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfanylquinolin-7-yl]oxypentanoate |
|---|---|
| PubChem CID | 15602833 |
| Molecular Formula | C34H35F3N4O5S |
| Molecular Weight | 668.74 g/mol |
| Exact Mass | 668.23 |
| IUPAC Name | cyclopentyl (2R)-2-amino-5-[6-methoxy-4-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfanylquinolin-7-yl]oxypentanoate |
| SMILES | COc1cc2c(Sc3ccc(NC(=O)Nc4ccc(C(F)(F)F)cc4)cc3)ccnc2cc1OCCC[C@@H](N)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C34H35F3N4O5S/c1-44-29-19-26-28(20-30(29)45-18-4-7-27(38)32(42)46-24-5-2-3-6-24)39-17-16-31(26)47-25-14-12-23(13-15-25)41-33(43)40-22-10-8-21(9-11-22)34(35,36)37/h8-17,19-20,24,27H,2-7,18,38H2,1H3,(H2,40,41,43)/t27-/m1/s1 |
| InChIKey | YBGVCYHKRLIRDD-HHHXNRCGSA-N |
| XLogP | 8.03 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.74 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|