C41H43N3O6 — CID 143322373
cyclohexyl (2S)-2-[4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxybutylamino]-2-phenylacetate (PubChem CID 143322373) has the molecular formula C41H43N3O6 and a molecular weight of 673.81 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxybutylamino]-2-phenylacetate.
| Compound Name | cyclohexyl (2S)-2-[4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxybutylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 143322373 |
| Molecular Formula | C41H43N3O6 |
| Molecular Weight | 673.81 g/mol |
| Exact Mass | 673.32 |
| IUPAC Name | cyclohexyl (2S)-2-[4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxybutylamino]-2-phenylacetate |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)c4ccccc4)cc3)ccnc2cc1OCCCCN[C@H](C(=O)OC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C41H43N3O6/c1-47-37-27-34-35(42-25-23-36(34)49-33-21-19-31(20-22-33)44-40(45)30-15-7-3-8-16-30)28-38(37)48-26-12-11-24-43-39(29-13-5-2-6-14-29)41(46)50-32-17-9-4-10-18-32/h2-3,5-8,13-16,19-23,25,27-28,32,39,43H,4,9-12,17-18,24,26H2,1H3,(H,44,45)/t39-/m0/s1 |
| InChIKey | JIWSDQPYMHLLRR-KDXMTYKHSA-N |
| XLogP | 8.65 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.81 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|