C39H39N3O6 — CID 15605215
cyclopentyl (2S)-2-[3-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxypropylamino]-2-phenylacetate (PubChem CID 15605215) has the molecular formula C39H39N3O6 and a molecular weight of 645.76 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[3-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxypropylamino]-2-phenylacetate.
| Compound Name | cyclopentyl (2S)-2-[3-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxypropylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 15605215 |
| Molecular Formula | C39H39N3O6 |
| Molecular Weight | 645.76 g/mol |
| Exact Mass | 645.28 |
| IUPAC Name | cyclopentyl (2S)-2-[3-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxypropylamino]-2-phenylacetate |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)c4ccccc4)cc3)ccnc2cc1OCCCN[C@H](C(=O)OC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C39H39N3O6/c1-45-35-25-32-33(40-23-21-34(32)47-31-19-17-29(18-20-31)42-38(43)28-13-6-3-7-14-28)26-36(35)46-24-10-22-41-37(27-11-4-2-5-12-27)39(44)48-30-15-8-9-16-30/h2-7,11-14,17-21,23,25-26,30,37,41H,8-10,15-16,22,24H2,1H3,(H,42,43)/t37-/m0/s1 |
| InChIKey | JLQHNOJGXOWGRA-QNGWXLTQSA-N |
| XLogP | 7.87 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.76 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|