C21H22N6O3 — CID 140884388
N-[4-[(6,7-dimethoxyquinolin-4-yl)amino]phenyl]-1,2,3,4-tetrahydro-1,2,4-triazine-6-carboxamide (PubChem CID 140884388) has the molecular formula C21H22N6O3 and a molecular weight of 406.45 g/mol. Its IUPAC name is N-[4-[(6,7-dimethoxyquinolin-4-yl)amino]phenyl]-1,2,3,4-tetrahydro-1,2,4-triazine-6-carboxamide.
| Compound Name | N-[4-[(6,7-dimethoxyquinolin-4-yl)amino]phenyl]-1,2,3,4-tetrahydro-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 140884388 |
| Molecular Formula | C21H22N6O3 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-[4-[(6,7-dimethoxyquinolin-4-yl)amino]phenyl]-1,2,3,4-tetrahydro-1,2,4-triazine-6-carboxamide |
| SMILES | COc1cc2nccc(Nc3ccc(NC(=O)C4=CNCNN4)cc3)c2cc1OC |
| InChI | InChI=1S/C21H22N6O3/c1-29-19-9-15-16(7-8-23-17(15)10-20(19)30-2)25-13-3-5-14(6-4-13)26-21(28)18-11-22-12-24-27-18/h3-11,22,24,27H,12H2,1-2H3,(H,23,25)(H,26,28) |
| InChIKey | PZTOTZCLGRVPTN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |