C25H22FN5O4 — CID 118612193
N'-[6-[(6,7-dimethoxyquinolin-4-yl)amino]-3-pyridinyl]-N-(4-fluorophenyl)propanediamide (PubChem CID 118612193) has the molecular formula C25H22FN5O4 and a molecular weight of 475.48 g/mol. Its IUPAC name is N'-[6-[(6,7-dimethoxyquinolin-4-yl)amino]-3-pyridinyl]-N-(4-fluorophenyl)propanediamide.
| Compound Name | N'-[6-[(6,7-dimethoxyquinolin-4-yl)amino]-3-pyridinyl]-N-(4-fluorophenyl)propanediamide |
|---|---|
| PubChem CID | 118612193 |
| Molecular Formula | C25H22FN5O4 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | N'-[6-[(6,7-dimethoxyquinolin-4-yl)amino]-3-pyridinyl]-N-(4-fluorophenyl)propanediamide |
| SMILES | COc1cc2nccc(Nc3ccc(NC(=O)CC(=O)Nc4ccc(F)cc4)cn3)c2cc1OC |
| InChI | InChI=1S/C25H22FN5O4/c1-34-21-11-18-19(9-10-27-20(18)12-22(21)35-2)31-23-8-7-17(14-28-23)30-25(33)13-24(32)29-16-5-3-15(26)4-6-16/h3-12,14H,13H2,1-2H3,(H,29,32)(H,30,33)(H,27,28,31) |
| InChIKey | CHOUUXRXJWXUGL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|