C23H18N6O2 — CID 162432035
N-[4-[4-(5-methylpyrazin-2-yl)oxyanilino]quinazolin-6-yl]but-2-ynamide (PubChem CID 162432035) has the molecular formula C23H18N6O2 and a molecular weight of 410.44 g/mol. Its IUPAC name is N-[4-[4-(5-methylpyrazin-2-yl)oxyanilino]quinazolin-6-yl]but-2-ynamide.
| Compound Name | N-[4-[4-(5-methylpyrazin-2-yl)oxyanilino]quinazolin-6-yl]but-2-ynamide |
|---|---|
| PubChem CID | 162432035 |
| Molecular Formula | C23H18N6O2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N-[4-[4-(5-methylpyrazin-2-yl)oxyanilino]quinazolin-6-yl]but-2-ynamide |
| SMILES | CC#CC(=O)Nc1ccc2ncnc(Nc3ccc(Oc4cnc(C)cn4)cc3)c2c1 |
| InChI | InChI=1S/C23H18N6O2/c1-3-4-21(30)28-17-7-10-20-19(11-17)23(27-14-26-20)29-16-5-8-18(9-6-16)31-22-13-24-15(2)12-25-22/h5-14H,1-2H3,(H,28,30)(H,26,27,29) |
| InChIKey | QPCKFRWLCYDWBZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|