C29H35N5OS — CID 162431650
N-[4-(4-cyclooctylsulfanylanilino)quinazolin-6-yl]-5-(dimethylamino)pent-2-ynamide (PubChem CID 162431650) has the molecular formula C29H35N5OS and a molecular weight of 501.70 g/mol. Its IUPAC name is N-[4-(4-cyclooctylsulfanylanilino)quinazolin-6-yl]-5-(dimethylamino)pent-2-ynamide.
| Compound Name | N-[4-(4-cyclooctylsulfanylanilino)quinazolin-6-yl]-5-(dimethylamino)pent-2-ynamide |
|---|---|
| PubChem CID | 162431650 |
| Molecular Formula | C29H35N5OS |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | N-[4-(4-cyclooctylsulfanylanilino)quinazolin-6-yl]-5-(dimethylamino)pent-2-ynamide |
| SMILES | CN(C)CCC#CC(=O)Nc1ccc2ncnc(Nc3ccc(SC4CCCCCCC4)cc3)c2c1 |
| InChI | InChI=1S/C29H35N5OS/c1-34(2)19-9-8-12-28(35)32-23-15-18-27-26(20-23)29(31-21-30-27)33-22-13-16-25(17-14-22)36-24-10-6-4-3-5-7-11-24/h13-18,20-21,24H,3-7,9-11,19H2,1-2H3,(H,32,35)(H,30,31,33) |
| InChIKey | ZKKARINJTOFINO-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|