C27H30N4O3 — CID 162431648
N-[4-(4-cyclooctyloxyanilino)quinazolin-6-yl]-5-hydroxypent-2-ynamide (PubChem CID 162431648) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is N-[4-(4-cyclooctyloxyanilino)quinazolin-6-yl]-5-hydroxypent-2-ynamide.
| Compound Name | N-[4-(4-cyclooctyloxyanilino)quinazolin-6-yl]-5-hydroxypent-2-ynamide |
|---|---|
| PubChem CID | 162431648 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | N-[4-(4-cyclooctyloxyanilino)quinazolin-6-yl]-5-hydroxypent-2-ynamide |
| SMILES | O=C(C#CCCO)Nc1ccc2ncnc(Nc3ccc(OC4CCCCCCC4)cc3)c2c1 |
| InChI | InChI=1S/C27H30N4O3/c32-17-7-6-10-26(33)30-21-13-16-25-24(18-21)27(29-19-28-25)31-20-11-14-23(15-12-20)34-22-8-4-2-1-3-5-9-22/h11-16,18-19,22,32H,1-5,7-9,17H2,(H,30,33)(H,28,29,31) |
| InChIKey | VGZTXJMVQRFZJJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|